C21H26ClNO3 — CID 23121328
3-[3-[4-[3-(4-chlorophenyl)propoxy]phenyl]propylamino]propanoic acid (PubChem CID 23121328) has the molecular formula C21H26ClNO3 and a molecular weight of 375.90 g/mol. Its IUPAC name is 3-[3-[4-[3-(4-chlorophenyl)propoxy]phenyl]propylamino]propanoic acid.
| Compound Name | 3-[3-[4-[3-(4-chlorophenyl)propoxy]phenyl]propylamino]propanoic acid |
|---|---|
| PubChem CID | 23121328 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-[3-[4-[3-(4-chlorophenyl)propoxy]phenyl]propylamino]propanoic acid |
| SMILES | O=C(O)CCNCCCc1ccc(OCCCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C21H26ClNO3/c22-19-9-5-18(6-10-19)4-2-16-26-20-11-7-17(8-12-20)3-1-14-23-15-13-21(24)25/h5-12,23H,1-4,13-16H2,(H,24,25) |
| InChIKey | TYAYARDNLUEQHR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|