C23H31NO5 — CID 23121193
3-[3-[4-[3-(3,4-dimethoxyphenyl)propoxy]phenyl]propylamino]propanoic acid (PubChem CID 23121193) has the molecular formula C23H31NO5 and a molecular weight of 401.50 g/mol. Its IUPAC name is 3-[3-[4-[3-(3,4-dimethoxyphenyl)propoxy]phenyl]propylamino]propanoic acid.
| Compound Name | 3-[3-[4-[3-(3,4-dimethoxyphenyl)propoxy]phenyl]propylamino]propanoic acid |
|---|---|
| PubChem CID | 23121193 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | 3-[3-[4-[3-(3,4-dimethoxyphenyl)propoxy]phenyl]propylamino]propanoic acid |
| SMILES | COc1ccc(CCCOc2ccc(CCCNCCC(=O)O)cc2)cc1OC |
| InChI | InChI=1S/C23H31NO5/c1-27-21-12-9-19(17-22(21)28-2)6-4-16-29-20-10-7-18(8-11-20)5-3-14-24-15-13-23(25)26/h7-12,17,24H,3-6,13-16H2,1-2H3,(H,25,26) |
| InChIKey | DVKXMKGKTIBGIP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|