C20H27ClN2O4 — CID 117068489
N-[4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]ethoxy]phenyl]acetamide;hydrochloride (PubChem CID 117068489) has the molecular formula C20H27ClN2O4 and a molecular weight of 394.90 g/mol. Its IUPAC name is N-[4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]ethoxy]phenyl]acetamide;hydrochloride.
| Compound Name | N-[4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]ethoxy]phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 117068489 |
| Molecular Formula | C20H27ClN2O4 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[4-[2-[2-(3,4-dimethoxyphenyl)ethylamino]ethoxy]phenyl]acetamide;hydrochloride |
| SMILES | COc1ccc(CCNCCOc2ccc(NC(C)=O)cc2)cc1OC.Cl |
| InChI | InChI=1S/C20H26N2O4.ClH/c1-15(23)22-17-5-7-18(8-6-17)26-13-12-21-11-10-16-4-9-19(24-2)20(14-16)25-3;/h4-9,14,21H,10-13H2,1-3H3,(H,22,23);1H |
| InChIKey | YUOLNQZMAPQSFF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|