C19H26ClNO4 — CID 17213243
2-[4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]phenoxy]ethanol;hydrochloride (PubChem CID 17213243) has the molecular formula C19H26ClNO4 and a molecular weight of 367.87 g/mol. Its IUPAC name is 2-[4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]phenoxy]ethanol;hydrochloride.
| Compound Name | 2-[4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]phenoxy]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17213243 |
| Molecular Formula | C19H26ClNO4 |
| Molecular Weight | 367.87 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-[4-[[2-(3,4-dimethoxyphenyl)ethylamino]methyl]phenoxy]ethanol;hydrochloride |
| SMILES | COc1ccc(CCNCc2ccc(OCCO)cc2)cc1OC.Cl |
| InChI | InChI=1S/C19H25NO4.ClH/c1-22-18-8-5-15(13-19(18)23-2)9-10-20-14-16-3-6-17(7-4-16)24-12-11-21;/h3-8,13,20-21H,9-12,14H2,1-2H3;1H |
| InChIKey | FJMCDBKQYRCIKJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.87 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|