C17H30ClNO4 — CID 17207962
2-[4-[(3-butoxypropylamino)methyl]-2-methoxyphenoxy]ethanol;hydrochloride (PubChem CID 17207962) has the molecular formula C17H30ClNO4 and a molecular weight of 347.88 g/mol. Its IUPAC name is 2-[4-[(3-butoxypropylamino)methyl]-2-methoxyphenoxy]ethanol;hydrochloride.
| Compound Name | 2-[4-[(3-butoxypropylamino)methyl]-2-methoxyphenoxy]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17207962 |
| Molecular Formula | C17H30ClNO4 |
| Molecular Weight | 347.88 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-[4-[(3-butoxypropylamino)methyl]-2-methoxyphenoxy]ethanol;hydrochloride |
| SMILES | CCCCOCCCNCc1ccc(OCCO)c(OC)c1.Cl |
| InChI | InChI=1S/C17H29NO4.ClH/c1-3-4-10-21-11-5-8-18-14-15-6-7-16(22-12-9-19)17(13-15)20-2;/h6-7,13,18-19H,3-5,8-12,14H2,1-2H3;1H |
| InChIKey | MOASKVUMYUUBLQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.88 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|