C16H27NO3 — CID 90741984
3-[[3-(butoxymethyl)-4-methoxyphenyl]methylamino]propan-1-ol (PubChem CID 90741984) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 3-[[3-(butoxymethyl)-4-methoxyphenyl]methylamino]propan-1-ol.
| Compound Name | 3-[[3-(butoxymethyl)-4-methoxyphenyl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 90741984 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 3-[[3-(butoxymethyl)-4-methoxyphenyl]methylamino]propan-1-ol |
| SMILES | CCCCOCc1cc(CNCCCO)ccc1OC |
| InChI | InChI=1S/C16H27NO3/c1-3-4-10-20-13-15-11-14(6-7-16(15)19-2)12-17-8-5-9-18/h6-7,11,17-18H,3-5,8-10,12-13H2,1-2H3 |
| InChIKey | PRGBPGUXABYVTE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|