C14H23NO3 — CID 62018577
1-[4-methoxy-3-(3-methoxypropoxymethyl)phenyl]-N-methylmethanamine (PubChem CID 62018577) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 1-[4-methoxy-3-(3-methoxypropoxymethyl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[4-methoxy-3-(3-methoxypropoxymethyl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 62018577 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 1-[4-methoxy-3-(3-methoxypropoxymethyl)phenyl]-N-methylmethanamine |
| SMILES | CNCc1ccc(OC)c(COCCCOC)c1 |
| InChI | InChI=1S/C14H23NO3/c1-15-10-12-5-6-14(17-3)13(9-12)11-18-8-4-7-16-2/h5-6,9,15H,4,7-8,10-11H2,1-3H3 |
| InChIKey | CKYAEIKDEQGFHT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|