C20H35NO2 — CID 83951182
N-[(3-methoxy-4-nonoxyphenyl)methyl]propan-1-amine (PubChem CID 83951182) has the molecular formula C20H35NO2 and a molecular weight of 321.51 g/mol. Its IUPAC name is N-[(3-methoxy-4-nonoxyphenyl)methyl]propan-1-amine.
| Compound Name | N-[(3-methoxy-4-nonoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 83951182 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.51 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | N-[(3-methoxy-4-nonoxyphenyl)methyl]propan-1-amine |
| SMILES | CCCCCCCCCOc1ccc(CNCCC)cc1OC |
| InChI | InChI=1S/C20H35NO2/c1-4-6-7-8-9-10-11-15-23-19-13-12-18(16-20(19)22-3)17-21-14-5-2/h12-13,16,21H,4-11,14-15,17H2,1-3H3 |
| InChIKey | ICHXEZTTWWOGLT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.51 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|