C20H36N2O2 — CID 54849213
N',N'-diethyl-N-[(4-hexoxy-3-methoxyphenyl)methyl]ethane-1,2-diamine (PubChem CID 54849213) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is N',N'-diethyl-N-[(4-hexoxy-3-methoxyphenyl)methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[(4-hexoxy-3-methoxyphenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 54849213 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | N',N'-diethyl-N-[(4-hexoxy-3-methoxyphenyl)methyl]ethane-1,2-diamine |
| SMILES | CCCCCCOc1ccc(CNCCN(CC)CC)cc1OC |
| InChI | InChI=1S/C20H36N2O2/c1-5-8-9-10-15-24-19-12-11-18(16-20(19)23-4)17-21-13-14-22(6-2)7-3/h11-12,16,21H,5-10,13-15,17H2,1-4H3 |
| InChIKey | XDYIHJPEZLOPDG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|