C19H34NO5P — CID 10287343
3-[(3-methoxy-4-octoxyphenyl)methylamino]propylphosphonic acid (PubChem CID 10287343) has the molecular formula C19H34NO5P and a molecular weight of 387.46 g/mol. Its IUPAC name is 3-[(3-methoxy-4-octoxyphenyl)methylamino]propylphosphonic acid.
| Compound Name | 3-[(3-methoxy-4-octoxyphenyl)methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 10287343 |
| Molecular Formula | C19H34NO5P |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 3-[(3-methoxy-4-octoxyphenyl)methylamino]propylphosphonic acid |
| SMILES | CCCCCCCCOc1ccc(CNCCCP(=O)(O)O)cc1OC |
| InChI | InChI=1S/C19H34NO5P/c1-3-4-5-6-7-8-13-25-18-11-10-17(15-19(18)24-2)16-20-12-9-14-26(21,22)23/h10-11,15,20H,3-9,12-14,16H2,1-2H3,(H2,21,22,23) |
| InChIKey | AXAGGQQXMQHIFF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|