C23H28F3NO5S — CID 23121741
3-[3-[4-(2-benzylsulfanylethoxy)phenyl]propylamino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 23121741) has the molecular formula C23H28F3NO5S and a molecular weight of 487.54 g/mol. Its IUPAC name is 3-[3-[4-(2-benzylsulfanylethoxy)phenyl]propylamino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[3-[4-(2-benzylsulfanylethoxy)phenyl]propylamino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23121741 |
| Molecular Formula | C23H28F3NO5S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 3-[3-[4-(2-benzylsulfanylethoxy)phenyl]propylamino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCNCCCc1ccc(OCCSCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H27NO3S.C2HF3O2/c23-21(24)12-14-22-13-4-7-18-8-10-20(11-9-18)25-15-16-26-17-19-5-2-1-3-6-19;3-2(4,5)1(6)7/h1-3,5-6,8-11,22H,4,7,12-17H2,(H,23,24);(H,6,7) |
| InChIKey | XFMFEMMJYJDTPD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|