C21H24F3NO6 — CID 68682395
3-[2-[4-(2-phenoxyethoxy)phenyl]ethylamino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 68682395) has the molecular formula C21H24F3NO6 and a molecular weight of 443.42 g/mol. Its IUPAC name is 3-[2-[4-(2-phenoxyethoxy)phenyl]ethylamino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[4-(2-phenoxyethoxy)phenyl]ethylamino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68682395 |
| Molecular Formula | C21H24F3NO6 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 3-[2-[4-(2-phenoxyethoxy)phenyl]ethylamino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCNCCc1ccc(OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO4.C2HF3O2/c21-19(22)11-13-20-12-10-16-6-8-18(9-7-16)24-15-14-23-17-4-2-1-3-5-17;3-2(4,5)1(6)7/h1-9,20H,10-15H2,(H,21,22);(H,6,7) |
| InChIKey | AKECQSJAPJNKNO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|