C17H21NO3S — CID 23121591
3-[2-[4-(2-thiophen-2-ylethoxy)phenyl]ethylamino]propanoic acid (PubChem CID 23121591) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is 3-[2-[4-(2-thiophen-2-ylethoxy)phenyl]ethylamino]propanoic acid.
| Compound Name | 3-[2-[4-(2-thiophen-2-ylethoxy)phenyl]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 23121591 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 3-[2-[4-(2-thiophen-2-ylethoxy)phenyl]ethylamino]propanoic acid |
| SMILES | O=C(O)CCNCCc1ccc(OCCc2cccs2)cc1 |
| InChI | InChI=1S/C17H21NO3S/c19-17(20)8-11-18-10-7-14-3-5-15(6-4-14)21-12-9-16-2-1-13-22-16/h1-6,13,18H,7-12H2,(H,19,20) |
| InChIKey | RCFJDCPOQBJYER-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|