C18H22ClNO2 — CID 10267968
3-(3,3-diphenylpropylamino)propanoic acid;hydrochloride (PubChem CID 10267968) has the molecular formula C18H22ClNO2 and a molecular weight of 319.83 g/mol. Its IUPAC name is 3-(3,3-diphenylpropylamino)propanoic acid;hydrochloride.
| Compound Name | 3-(3,3-diphenylpropylamino)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 10267968 |
| Molecular Formula | C18H22ClNO2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3-(3,3-diphenylpropylamino)propanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCNCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO2.ClH/c20-18(21)12-14-19-13-11-17(15-7-3-1-4-8-15)16-9-5-2-6-10-16;/h1-10,17,19H,11-14H2,(H,20,21);1H |
| InChIKey | LHWRJZTVFRXENR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|