C17H20N2O3 — CID 157477952
3,3-diphenylpropylurea;formic acid (PubChem CID 157477952) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3,3-diphenylpropylurea;formic acid.
| Compound Name | 3,3-diphenylpropylurea;formic acid |
|---|---|
| PubChem CID | 157477952 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 3,3-diphenylpropylurea;formic acid |
| SMILES | NC(=O)NCCC(c1ccccc1)c1ccccc1.O=CO |
| InChI | InChI=1S/C16H18N2O.CH2O2/c17-16(19)18-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14;2-1-3/h1-10,15H,11-12H2,(H3,17,18,19);1H,(H,2,3) |
| InChIKey | BVUXOHUSNGDKIL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|