C23H31NOS2 — CID 102039118
N-(3,3-diphenylpropyl)-7,8-bis(sulfanyl)octanamide (PubChem CID 102039118) has the molecular formula C23H31NOS2 and a molecular weight of 401.64 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-7,8-bis(sulfanyl)octanamide.
| Compound Name | N-(3,3-diphenylpropyl)-7,8-bis(sulfanyl)octanamide |
|---|---|
| PubChem CID | 102039118 |
| Molecular Formula | C23H31NOS2 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-(3,3-diphenylpropyl)-7,8-bis(sulfanyl)octanamide |
| SMILES | O=C(CCCCCC(S)CS)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31NOS2/c25-23(15-9-3-8-14-21(27)18-26)24-17-16-22(19-10-4-1-5-11-19)20-12-6-2-7-13-20/h1-2,4-7,10-13,21-22,26-27H,3,8-9,14-18H2,(H,24,25) |
| InChIKey | LGVGZKRZMAPNKO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|