C31H39N3O2 — CID 4541760
6-amino-N-benzyl-N-[3-(3,3-diphenylpropylamino)-3-oxopropyl]hexanamide (PubChem CID 4541760) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is 6-amino-N-benzyl-N-[3-(3,3-diphenylpropylamino)-3-oxopropyl]hexanamide.
| Compound Name | 6-amino-N-benzyl-N-[3-(3,3-diphenylpropylamino)-3-oxopropyl]hexanamide |
|---|---|
| PubChem CID | 4541760 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 6-amino-N-benzyl-N-[3-(3,3-diphenylpropylamino)-3-oxopropyl]hexanamide |
| SMILES | NCCCCCC(=O)N(CCC(=O)NCCC(c1ccccc1)c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H39N3O2/c32-22-12-4-11-19-31(36)34(25-26-13-5-1-6-14-26)24-21-30(35)33-23-20-29(27-15-7-2-8-16-27)28-17-9-3-10-18-28/h1-3,5-10,13-18,29H,4,11-12,19-25,32H2,(H,33,35) |
| InChIKey | PIOODVCSRFERJS-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|