C27H38N4O2 — CID 3932380
6-amino-N-benzyl-N-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]hexanamide (PubChem CID 3932380) has the molecular formula C27H38N4O2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 6-amino-N-benzyl-N-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]hexanamide.
| Compound Name | 6-amino-N-benzyl-N-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]hexanamide |
|---|---|
| PubChem CID | 3932380 |
| Molecular Formula | C27H38N4O2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 6-amino-N-benzyl-N-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]hexanamide |
| SMILES | NCCCCCC(=O)N(CCC(=O)N1CCN(Cc2ccccc2)CC1)Cc1ccccc1 |
| InChI | InChI=1S/C27H38N4O2/c28-16-9-3-8-14-26(32)31(23-25-12-6-2-7-13-25)17-15-27(33)30-20-18-29(19-21-30)22-24-10-4-1-5-11-24/h1-2,4-7,10-13H,3,8-9,14-23,28H2 |
| InChIKey | WFMONIHMGHZZGC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|