C29H41N3O2 — CID 42700275
N-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-N,4-dibutylbenzamide (PubChem CID 42700275) has the molecular formula C29H41N3O2 and a molecular weight of 463.67 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-N,4-dibutylbenzamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-N,4-dibutylbenzamide |
|---|---|
| PubChem CID | 42700275 |
| Molecular Formula | C29H41N3O2 |
| Molecular Weight | 463.67 g/mol |
| Exact Mass | 463.32 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-N,4-dibutylbenzamide |
| SMILES | CCCCc1ccc(C(=O)N(CCCC)CCC(=O)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H41N3O2/c1-3-5-10-25-13-15-27(16-14-25)29(34)32(18-6-4-2)19-17-28(33)31-22-20-30(21-23-31)24-26-11-8-7-9-12-26/h7-9,11-16H,3-6,10,17-24H2,1-2H3 |
| InChIKey | DNJRAFBZCCHEOO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |