C29H37N3O3 — CID 3361345
6-amino-N-[3-(3,3-diphenylpropylamino)-3-oxopropyl]-N-(furan-2-ylmethyl)hexanamide (PubChem CID 3361345) has the molecular formula C29H37N3O3 and a molecular weight of 475.63 g/mol. Its IUPAC name is 6-amino-N-[3-(3,3-diphenylpropylamino)-3-oxopropyl]-N-(furan-2-ylmethyl)hexanamide.
| Compound Name | 6-amino-N-[3-(3,3-diphenylpropylamino)-3-oxopropyl]-N-(furan-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 3361345 |
| Molecular Formula | C29H37N3O3 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | 6-amino-N-[3-(3,3-diphenylpropylamino)-3-oxopropyl]-N-(furan-2-ylmethyl)hexanamide |
| SMILES | NCCCCCC(=O)N(CCC(=O)NCCC(c1ccccc1)c1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C29H37N3O3/c30-19-9-3-8-16-29(34)32(23-26-15-10-22-35-26)21-18-28(33)31-20-17-27(24-11-4-1-5-12-24)25-13-6-2-7-14-25/h1-2,4-7,10-15,22,27H,3,8-9,16-21,23,30H2,(H,31,33) |
| InChIKey | KCFGBMREXVULQM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|