C21H28N4O4 — CID 3205151
N'-(furan-2-ylmethyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide (PubChem CID 3205151) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is N'-(furan-2-ylmethyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide.
| Compound Name | N'-(furan-2-ylmethyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
|---|---|
| PubChem CID | 3205151 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | N'-(furan-2-ylmethyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
| SMILES | CC(C)CCNC(=O)CN(Cc1ccco1)C(=O)CCC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C21H28N4O4/c1-16(2)10-12-23-20(27)15-25(14-17-6-5-13-29-17)21(28)9-8-19(26)24-18-7-3-4-11-22-18/h3-7,11,13,16H,8-10,12,14-15H2,1-2H3,(H,23,27)(H,22,24,26) |
| InChIKey | LZBCOAQLQBHGQP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |