C19H24N4O3S — CID 3204981
N'-[2-oxo-2-(propan-2-ylamino)ethyl]-N-pyridin-2-yl-N'-(thiophen-2-ylmethyl)butanediamide (PubChem CID 3204981) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is N'-[2-oxo-2-(propan-2-ylamino)ethyl]-N-pyridin-2-yl-N'-(thiophen-2-ylmethyl)butanediamide.
| Compound Name | N'-[2-oxo-2-(propan-2-ylamino)ethyl]-N-pyridin-2-yl-N'-(thiophen-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 3204981 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N'-[2-oxo-2-(propan-2-ylamino)ethyl]-N-pyridin-2-yl-N'-(thiophen-2-ylmethyl)butanediamide |
| SMILES | CC(C)NC(=O)CN(Cc1cccs1)C(=O)CCC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C19H24N4O3S/c1-14(2)21-18(25)13-23(12-15-6-5-11-27-15)19(26)9-8-17(24)22-16-7-3-4-10-20-16/h3-7,10-11,14H,8-9,12-13H2,1-2H3,(H,21,25)(H,20,22,24) |
| InChIKey | QPGIWRCMEOLBES-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |