C25H25ClN4O3 — CID 3204817
N'-[2-(benzylamino)-2-oxoethyl]-N'-[(2-chlorophenyl)methyl]-N-pyridin-2-ylbutanediamide (PubChem CID 3204817) has the molecular formula C25H25ClN4O3 and a molecular weight of 464.95 g/mol. Its IUPAC name is N'-[2-(benzylamino)-2-oxoethyl]-N'-[(2-chlorophenyl)methyl]-N-pyridin-2-ylbutanediamide.
| Compound Name | N'-[2-(benzylamino)-2-oxoethyl]-N'-[(2-chlorophenyl)methyl]-N-pyridin-2-ylbutanediamide |
|---|---|
| PubChem CID | 3204817 |
| Molecular Formula | C25H25ClN4O3 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N'-[2-(benzylamino)-2-oxoethyl]-N'-[(2-chlorophenyl)methyl]-N-pyridin-2-ylbutanediamide |
| SMILES | O=C(CN(Cc1ccccc1Cl)C(=O)CCC(=O)Nc1ccccn1)NCc1ccccc1 |
| InChI | InChI=1S/C25H25ClN4O3/c26-21-11-5-4-10-20(21)17-30(18-24(32)28-16-19-8-2-1-3-9-19)25(33)14-13-23(31)29-22-12-6-7-15-27-22/h1-12,15H,13-14,16-18H2,(H,28,32)(H,27,29,31) |
| InChIKey | XDZUYYCSYADIBY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |