C17H17ClN2O2 — CID 108945203
N-benzyl-N'-[(2-chlorophenyl)methyl]propanediamide (PubChem CID 108945203) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is N-benzyl-N'-[(2-chlorophenyl)methyl]propanediamide.
| Compound Name | N-benzyl-N'-[(2-chlorophenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 108945203 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-benzyl-N'-[(2-chlorophenyl)methyl]propanediamide |
| SMILES | O=C(CC(=O)NCc1ccccc1Cl)NCc1ccccc1 |
| InChI | InChI=1S/C17H17ClN2O2/c18-15-9-5-4-8-14(15)12-20-17(22)10-16(21)19-11-13-6-2-1-3-7-13/h1-9H,10-12H2,(H,19,21)(H,20,22) |
| InChIKey | KIEXPXHARKMEBM-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|