C20H22ClN3O3 — CID 17179143
N-benzyl-4-[2-[3-(2-chlorophenyl)propanoyl]hydrazinyl]-4-oxobutanamide (PubChem CID 17179143) has the molecular formula C20H22ClN3O3 and a molecular weight of 387.87 g/mol. Its IUPAC name is N-benzyl-4-[2-[3-(2-chlorophenyl)propanoyl]hydrazinyl]-4-oxobutanamide.
| Compound Name | N-benzyl-4-[2-[3-(2-chlorophenyl)propanoyl]hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 17179143 |
| Molecular Formula | C20H22ClN3O3 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-benzyl-4-[2-[3-(2-chlorophenyl)propanoyl]hydrazinyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)NNC(=O)CCc1ccccc1Cl)NCc1ccccc1 |
| InChI | InChI=1S/C20H22ClN3O3/c21-17-9-5-4-8-16(17)10-11-19(26)23-24-20(27)13-12-18(25)22-14-15-6-2-1-3-7-15/h1-9H,10-14H2,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | XBMBFTZUSZFJDL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|