C22H27FN4O3 — CID 3205158
N'-(4-fluorophenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide (PubChem CID 3205158) has the molecular formula C22H27FN4O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide.
| Compound Name | N'-(4-fluorophenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
|---|---|
| PubChem CID | 3205158 |
| Molecular Formula | C22H27FN4O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N'-(4-fluorophenyl)-N'-[2-(3-methylbutylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
| SMILES | CC(C)CCNC(=O)CN(C(=O)CCC(=O)Nc1ccccn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H27FN4O3/c1-16(2)12-14-25-21(29)15-27(18-8-6-17(23)7-9-18)22(30)11-10-20(28)26-19-5-3-4-13-24-19/h3-9,13,16H,10-12,14-15H2,1-2H3,(H,25,29)(H,24,26,28) |
| InChIKey | FMWUROHEWQQGOP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |