C22H28N4O4 — CID 3205189
N'-(2-ethylphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide (PubChem CID 3205189) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is N'-(2-ethylphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide.
| Compound Name | N'-(2-ethylphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
|---|---|
| PubChem CID | 3205189 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | N'-(2-ethylphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
| SMILES | CCc1ccccc1N(CC(=O)NCCOC)C(=O)CCC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C22H28N4O4/c1-3-17-8-4-5-9-18(17)26(16-21(28)24-14-15-30-2)22(29)12-11-20(27)25-19-10-6-7-13-23-19/h4-10,13H,3,11-12,14-16H2,1-2H3,(H,24,28)(H,23,25,27) |
| InChIKey | PKFMDQSCWRNLSO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|