C25H34N4O6 — CID 40901811
N'-[(1R)-1-(4-ethoxyphenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyethyl)-N-pyridin-2-ylbutanediamide (PubChem CID 40901811) has the molecular formula C25H34N4O6 and a molecular weight of 486.57 g/mol. Its IUPAC name is N'-[(1R)-1-(4-ethoxyphenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyethyl)-N-pyridin-2-ylbutanediamide.
| Compound Name | N'-[(1R)-1-(4-ethoxyphenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyethyl)-N-pyridin-2-ylbutanediamide |
|---|---|
| PubChem CID | 40901811 |
| Molecular Formula | C25H34N4O6 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | N'-[(1R)-1-(4-ethoxyphenyl)-2-(2-methoxyethylamino)-2-oxoethyl]-N'-(2-methoxyethyl)-N-pyridin-2-ylbutanediamide |
| SMILES | CCOc1ccc([C@H](C(=O)NCCOC)N(CCOC)C(=O)CCC(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C25H34N4O6/c1-4-35-20-10-8-19(9-11-20)24(25(32)27-15-17-33-2)29(16-18-34-3)23(31)13-12-22(30)28-21-7-5-6-14-26-21/h5-11,14,24H,4,12-13,15-18H2,1-3H3,(H,27,32)(H,26,28,30)/t24-/m1/s1 |
| InChIKey | ALGHLJIGAFWWMG-XMMPIXPASA-N |
| XLogP | 2.18 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|