C22H28N4O6 — CID 3846179
N'-(2,4-dimethoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide (PubChem CID 3846179) has the molecular formula C22H28N4O6 and a molecular weight of 444.49 g/mol. Its IUPAC name is N'-(2,4-dimethoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide.
| Compound Name | N'-(2,4-dimethoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
|---|---|
| PubChem CID | 3846179 |
| Molecular Formula | C22H28N4O6 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N'-(2,4-dimethoxyphenyl)-N'-[2-(2-methoxyethylamino)-2-oxoethyl]-N-pyridin-2-ylbutanediamide |
| SMILES | COCCNC(=O)CN(C(=O)CCC(=O)Nc1ccccn1)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C22H28N4O6/c1-30-13-12-24-21(28)15-26(17-8-7-16(31-2)14-18(17)32-3)22(29)10-9-20(27)25-19-6-4-5-11-23-19/h4-8,11,14H,9-10,12-13,15H2,1-3H3,(H,24,28)(H,23,25,27) |
| InChIKey | DZJKNZMNSDQBLS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|