C14H24N2O3 — CID 86999017
1-(furan-2-ylmethyl)-1-(2-methoxyethyl)-3-(3-methylbutyl)urea (PubChem CID 86999017) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-1-(2-methoxyethyl)-3-(3-methylbutyl)urea.
| Compound Name | 1-(furan-2-ylmethyl)-1-(2-methoxyethyl)-3-(3-methylbutyl)urea |
|---|---|
| PubChem CID | 86999017 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-(furan-2-ylmethyl)-1-(2-methoxyethyl)-3-(3-methylbutyl)urea |
| SMILES | COCCN(Cc1ccco1)C(=O)NCCC(C)C |
| InChI | InChI=1S/C14H24N2O3/c1-12(2)6-7-15-14(17)16(8-10-18-3)11-13-5-4-9-19-13/h4-5,9,12H,6-8,10-11H2,1-3H3,(H,15,17) |
| InChIKey | BHWYLYQQAIRDEE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |