C17H21ClN2O4 — CID 87008094
3-[(5-chloro-2-methoxyphenyl)methyl]-1-(furan-2-ylmethyl)-1-(2-methoxyethyl)urea (PubChem CID 87008094) has the molecular formula C17H21ClN2O4 and a molecular weight of 352.82 g/mol. Its IUPAC name is 3-[(5-chloro-2-methoxyphenyl)methyl]-1-(furan-2-ylmethyl)-1-(2-methoxyethyl)urea.
| Compound Name | 3-[(5-chloro-2-methoxyphenyl)methyl]-1-(furan-2-ylmethyl)-1-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 87008094 |
| Molecular Formula | C17H21ClN2O4 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 3-[(5-chloro-2-methoxyphenyl)methyl]-1-(furan-2-ylmethyl)-1-(2-methoxyethyl)urea |
| SMILES | COCCN(Cc1ccco1)C(=O)NCc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C17H21ClN2O4/c1-22-9-7-20(12-15-4-3-8-24-15)17(21)19-11-13-10-14(18)5-6-16(13)23-2/h3-6,8,10H,7,9,11-12H2,1-2H3,(H,19,21) |
| InChIKey | NRWRTFIHSMLDLM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |