C17H20ClN3O4 — CID 9136719
2-[(5-chloro-2-methoxyphenyl)methyl-methylamino]-N-(furan-2-ylmethylcarbamoyl)acetamide (PubChem CID 9136719) has the molecular formula C17H20ClN3O4 and a molecular weight of 365.82 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxyphenyl)methyl-methylamino]-N-(furan-2-ylmethylcarbamoyl)acetamide.
| Compound Name | 2-[(5-chloro-2-methoxyphenyl)methyl-methylamino]-N-(furan-2-ylmethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 9136719 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 2-[(5-chloro-2-methoxyphenyl)methyl-methylamino]-N-(furan-2-ylmethylcarbamoyl)acetamide |
| SMILES | COc1ccc(Cl)cc1CN(C)CC(=O)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H20ClN3O4/c1-21(10-12-8-13(18)5-6-15(12)24-2)11-16(22)20-17(23)19-9-14-4-3-7-25-14/h3-8H,9-11H2,1-2H3,(H2,19,20,22,23) |
| InChIKey | BKVUXMVDBDPFIH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |