C15H14ClNO5 — CID 2629968
[2-(furan-2-ylmethylamino)-2-oxoethyl] 5-chloro-2-methoxybenzoate (PubChem CID 2629968) has the molecular formula C15H14ClNO5 and a molecular weight of 323.73 g/mol. Its IUPAC name is [2-(furan-2-ylmethylamino)-2-oxoethyl] 5-chloro-2-methoxybenzoate.
| Compound Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 5-chloro-2-methoxybenzoate |
|---|---|
| PubChem CID | 2629968 |
| Molecular Formula | C15H14ClNO5 |
| Molecular Weight | 323.73 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | [2-(furan-2-ylmethylamino)-2-oxoethyl] 5-chloro-2-methoxybenzoate |
| SMILES | COc1ccc(Cl)cc1C(=O)OCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H14ClNO5/c1-20-13-5-4-10(16)7-12(13)15(19)22-9-14(18)17-8-11-3-2-6-21-11/h2-7H,8-9H2,1H3,(H,17,18) |
| InChIKey | AKNSSMUJSDJMMB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.73 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |