C15H17ClN2O5S — CID 6493708
2-[(5-chloro-2-methoxyphenyl)sulfonyl-methylamino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 6493708) has the molecular formula C15H17ClN2O5S and a molecular weight of 372.83 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxyphenyl)sulfonyl-methylamino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[(5-chloro-2-methoxyphenyl)sulfonyl-methylamino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 6493708 |
| Molecular Formula | C15H17ClN2O5S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2-[(5-chloro-2-methoxyphenyl)sulfonyl-methylamino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)N(C)CC(=O)NCc1ccco1 |
| InChI | InChI=1S/C15H17ClN2O5S/c1-18(10-15(19)17-9-12-4-3-7-23-12)24(20,21)14-8-11(16)5-6-13(14)22-2/h3-8H,9-10H2,1-2H3,(H,17,19) |
| InChIKey | BJZCQOLSWGKLKN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |