C17H20ClN3O4 — CID 51127338
3-(5-chloro-2-methoxyanilino)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]propanamide (PubChem CID 51127338) has the molecular formula C17H20ClN3O4 and a molecular weight of 365.82 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyanilino)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]propanamide.
| Compound Name | 3-(5-chloro-2-methoxyanilino)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 51127338 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 3-(5-chloro-2-methoxyanilino)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]propanamide |
| SMILES | COc1ccc(Cl)cc1NCCC(=O)NCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H20ClN3O4/c1-24-15-5-4-12(18)9-14(15)19-7-6-16(22)21-11-17(23)20-10-13-3-2-8-25-13/h2-5,8-9,19H,6-7,10-11H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | QAAYKEBEAOZCEK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |