C17H19ClN2O4 — CID 55512609
3-(3-chloro-4-methoxyphenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]propanamide (PubChem CID 55512609) has the molecular formula C17H19ClN2O4 and a molecular weight of 350.80 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]propanamide.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 55512609 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]propanamide |
| SMILES | COc1ccc(CCC(=O)NCC(=O)NCc2ccco2)cc1Cl |
| InChI | InChI=1S/C17H19ClN2O4/c1-23-15-6-4-12(9-14(15)18)5-7-16(21)20-11-17(22)19-10-13-3-2-8-24-13/h2-4,6,8-9H,5,7,10-11H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | RMAPWWATCRMEDF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |