C12H12ClNO4S — CID 686051
5-chloro-N-(furan-2-ylmethyl)-2-methoxybenzenesulfonamide (PubChem CID 686051) has the molecular formula C12H12ClNO4S and a molecular weight of 301.75 g/mol. Its IUPAC name is 5-chloro-N-(furan-2-ylmethyl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-chloro-N-(furan-2-ylmethyl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 686051 |
| Molecular Formula | C12H12ClNO4S |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 5-chloro-N-(furan-2-ylmethyl)-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)NCc1ccco1 |
| InChI | InChI=1S/C12H12ClNO4S/c1-17-11-5-4-9(13)7-12(11)19(15,16)14-8-10-3-2-6-18-10/h2-7,14H,8H2,1H3 |
| InChIKey | JOJLBFRCNLWGBU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |