C23H20ClNO7S — CID 1191209
[2-(4-chlorophenyl)-2-oxoethyl] (E)-3-[3-(furan-2-ylmethylsulfamoyl)-4-methoxyphenyl]prop-2-enoate (PubChem CID 1191209) has the molecular formula C23H20ClNO7S and a molecular weight of 489.93 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] (E)-3-[3-(furan-2-ylmethylsulfamoyl)-4-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] (E)-3-[3-(furan-2-ylmethylsulfamoyl)-4-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 1191209 |
| Molecular Formula | C23H20ClNO7S |
| Molecular Weight | 489.93 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] (E)-3-[3-(furan-2-ylmethylsulfamoyl)-4-methoxyphenyl]prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)c2ccc(Cl)cc2)cc1S(=O)(=O)NCc1ccco1 |
| InChI | InChI=1S/C23H20ClNO7S/c1-30-21-10-4-16(13-22(21)33(28,29)25-14-19-3-2-12-31-19)5-11-23(27)32-15-20(26)17-6-8-18(24)9-7-17/h2-13,25H,14-15H2,1H3/b11-5+ |
| InChIKey | RHRHYRNUWNCIAY-VZUCSPMQSA-N |
| XLogP | 3.86 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.93 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|