C17H14ClFN2O5 — CID 7880756
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate (PubChem CID 7880756) has the molecular formula C17H14ClFN2O5 and a molecular weight of 380.76 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7880756 |
| Molecular Formula | C17H14ClFN2O5 |
| Molecular Weight | 380.76 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] (E)-3-(3-chloro-4-fluorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc(F)c(Cl)c1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C17H14ClFN2O5/c18-13-8-11(3-5-14(13)19)4-6-16(23)26-10-15(22)21-17(24)20-9-12-2-1-7-25-12/h1-8H,9-10H2,(H2,20,21,22,24)/b6-4+ |
| InChIKey | JQFRKPBTJRTYOW-GQCTYLIASA-N |
| XLogP | 2.65 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.76 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|