C19H16N4O5 — CID 2552575
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate (PubChem CID 2552575) has the molecular formula C19H16N4O5 and a molecular weight of 380.36 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 2552575 |
| Molecular Formula | C19H16N4O5 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] (E)-3-quinoxalin-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cnc2ccccc2n1)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C19H16N4O5/c24-17(23-19(26)21-11-14-4-3-9-27-14)12-28-18(25)8-7-13-10-20-15-5-1-2-6-16(15)22-13/h1-10H,11-12H2,(H2,21,23,24,26)/b8-7+ |
| InChIKey | ABUREYNLDBMEGH-BQYQJAHWSA-N |
| XLogP | 1.81 |
| TPSA | 123.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|