C25H21N3O5 — CID 16532309
[2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate (PubChem CID 16532309) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate.
| Compound Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 16532309 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | [2-(furan-2-ylmethylcarbamoylamino)-2-oxoethyl] 3-methyl-2-phenylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2ccccc2)nc2ccccc2c1C(=O)OCC(=O)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C25H21N3O5/c1-16-22(19-11-5-6-12-20(19)27-23(16)17-8-3-2-4-9-17)24(30)33-15-21(29)28-25(31)26-14-18-10-7-13-32-18/h2-13H,14-15H2,1H3,(H2,26,28,29,31) |
| InChIKey | BUKLWHURCXNNOU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |