C26H20N2O4 — CID 41499799
(2-benzamido-2-oxoethyl) 3-methyl-2-phenylquinoline-4-carboxylate (PubChem CID 41499799) has the molecular formula C26H20N2O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is (2-benzamido-2-oxoethyl) 3-methyl-2-phenylquinoline-4-carboxylate.
| Compound Name | (2-benzamido-2-oxoethyl) 3-methyl-2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 41499799 |
| Molecular Formula | C26H20N2O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (2-benzamido-2-oxoethyl) 3-methyl-2-phenylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2ccccc2)nc2ccccc2c1C(=O)OCC(=O)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H20N2O4/c1-17-23(26(31)32-16-22(29)28-25(30)19-12-6-3-7-13-19)20-14-8-9-15-21(20)27-24(17)18-10-4-2-5-11-18/h2-15H,16H2,1H3,(H,28,29,30) |
| InChIKey | CNMKWFYTMFPCPJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |