C32H25ClN2O3 — CID 2366069
[2-(benzhydrylamino)-2-oxoethyl] 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate (PubChem CID 2366069) has the molecular formula C32H25ClN2O3 and a molecular weight of 521.02 g/mol. Its IUPAC name is [2-(benzhydrylamino)-2-oxoethyl] 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate.
| Compound Name | [2-(benzhydrylamino)-2-oxoethyl] 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2366069 |
| Molecular Formula | C32H25ClN2O3 |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | [2-(benzhydrylamino)-2-oxoethyl] 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2cccc(Cl)c2)nc2ccccc2c1C(=O)OCC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H25ClN2O3/c1-21-29(26-17-8-9-18-27(26)34-30(21)24-15-10-16-25(33)19-24)32(37)38-20-28(36)35-31(22-11-4-2-5-12-22)23-13-6-3-7-14-23/h2-19,31H,20H2,1H3,(H,35,36) |
| InChIKey | BCLDEHCRIWYEBH-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |