C25H18ClN3O2 — CID 2453853
1H-benzimidazol-2-ylmethyl 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate (PubChem CID 2453853) has the molecular formula C25H18ClN3O2 and a molecular weight of 427.89 g/mol. Its IUPAC name is 1H-benzimidazol-2-ylmethyl 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate.
| Compound Name | 1H-benzimidazol-2-ylmethyl 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2453853 |
| Molecular Formula | C25H18ClN3O2 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 1H-benzimidazol-2-ylmethyl 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2cccc(Cl)c2)nc2ccccc2c1C(=O)OCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H18ClN3O2/c1-15-23(25(30)31-14-22-27-20-11-4-5-12-21(20)28-22)18-9-2-3-10-19(18)29-24(15)16-7-6-8-17(26)13-16/h2-13H,14H2,1H3,(H,27,28) |
| InChIKey | FUHMCZGPRLPAPF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |