C21H16ClNO4 — CID 2580520
[(3R)-2-oxooxolan-3-yl] 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate (PubChem CID 2580520) has the molecular formula C21H16ClNO4 and a molecular weight of 381.81 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2580520 |
| Molecular Formula | C21H16ClNO4 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 2-(3-chlorophenyl)-3-methylquinoline-4-carboxylate |
| SMILES | Cc1c(-c2cccc(Cl)c2)nc2ccccc2c1C(=O)O[C@@H]1CCOC1=O |
| InChI | InChI=1S/C21H16ClNO4/c1-12-18(21(25)27-17-9-10-26-20(17)24)15-7-2-3-8-16(15)23-19(12)13-5-4-6-14(22)11-13/h2-8,11,17H,9-10H2,1H3/t17-/m1/s1 |
| InChIKey | KDTRNQWGQIXSBZ-QGZVFWFLSA-N |
| XLogP | 4.34 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |