C20H14ClNO4 — CID 3877730
(2-oxooxolan-3-yl) 2-(4-chlorophenyl)quinoline-4-carboxylate (PubChem CID 3877730) has the molecular formula C20H14ClNO4 and a molecular weight of 367.79 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 2-(4-chlorophenyl)quinoline-4-carboxylate.
| Compound Name | (2-oxooxolan-3-yl) 2-(4-chlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3877730 |
| Molecular Formula | C20H14ClNO4 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | (2-oxooxolan-3-yl) 2-(4-chlorophenyl)quinoline-4-carboxylate |
| SMILES | O=C(OC1CCOC1=O)c1cc(-c2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C20H14ClNO4/c21-13-7-5-12(6-8-13)17-11-15(14-3-1-2-4-16(14)22-17)19(23)26-18-9-10-25-20(18)24/h1-8,11,18H,9-10H2 |
| InChIKey | ZKCNFYXILVBSSV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |