C23H14ClNO4 — CID 5011282
1,3-benzodioxol-5-yl 2-(4-chlorophenyl)quinoline-4-carboxylate (PubChem CID 5011282) has the molecular formula C23H14ClNO4 and a molecular weight of 403.82 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 2-(4-chlorophenyl)quinoline-4-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 2-(4-chlorophenyl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 5011282 |
| Molecular Formula | C23H14ClNO4 |
| Molecular Weight | 403.82 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 1,3-benzodioxol-5-yl 2-(4-chlorophenyl)quinoline-4-carboxylate |
| SMILES | O=C(Oc1ccc2c(c1)OCO2)c1cc(-c2ccc(Cl)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H14ClNO4/c24-15-7-5-14(6-8-15)20-12-18(17-3-1-2-4-19(17)25-20)23(26)29-16-9-10-21-22(11-16)28-13-27-21/h1-12H,13H2 |
| InChIKey | KVKAWUVUFIHOHJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.82 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|