C21H17NO5 — CID 7132382
[(3S)-2-oxooxolan-3-yl] 6-methoxy-2-phenylquinoline-4-carboxylate (PubChem CID 7132382) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is [(3S)-2-oxooxolan-3-yl] 6-methoxy-2-phenylquinoline-4-carboxylate.
| Compound Name | [(3S)-2-oxooxolan-3-yl] 6-methoxy-2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7132382 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [(3S)-2-oxooxolan-3-yl] 6-methoxy-2-phenylquinoline-4-carboxylate |
| SMILES | COc1ccc2nc(-c3ccccc3)cc(C(=O)O[C@H]3CCOC3=O)c2c1 |
| InChI | InChI=1S/C21H17NO5/c1-25-14-7-8-17-15(11-14)16(20(23)27-19-9-10-26-21(19)24)12-18(22-17)13-5-3-2-4-6-13/h2-8,11-12,19H,9-10H2,1H3/t19-/m0/s1 |
| InChIKey | NEKNKCIYWKRTTP-IBGZPJMESA-N |
| XLogP | 3.38 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |