C18H13NO5 — CID 2082794
[(3R)-2-oxooxolan-3-yl] 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 2082794) has the molecular formula C18H13NO5 and a molecular weight of 323.30 g/mol. Its IUPAC name is [(3R)-2-oxooxolan-3-yl] 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | [(3R)-2-oxooxolan-3-yl] 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 2082794 |
| Molecular Formula | C18H13NO5 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | [(3R)-2-oxooxolan-3-yl] 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | O=C(O[C@@H]1CCOC1=O)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C18H13NO5/c20-17(24-16-7-9-23-18(16)21)12-10-14(15-6-3-8-22-15)19-13-5-2-1-4-11(12)13/h1-6,8,10,16H,7,9H2/t16-/m1/s1 |
| InChIKey | UOTBLQAJZXELKJ-MRXNPFEDSA-N |
| XLogP | 2.97 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |