C23H14N2O5 — CID 7825277
(1,3-dioxoisoindol-2-yl)methyl 2-(furan-2-yl)quinoline-4-carboxylate (PubChem CID 7825277) has the molecular formula C23H14N2O5 and a molecular weight of 398.37 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 2-(furan-2-yl)quinoline-4-carboxylate.
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 2-(furan-2-yl)quinoline-4-carboxylate |
|---|---|
| PubChem CID | 7825277 |
| Molecular Formula | C23H14N2O5 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 2-(furan-2-yl)quinoline-4-carboxylate |
| SMILES | O=C(OCN1C(=O)c2ccccc2C1=O)c1cc(-c2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C23H14N2O5/c26-21-15-7-1-2-8-16(15)22(27)25(21)13-30-23(28)17-12-19(20-10-5-11-29-20)24-18-9-4-3-6-14(17)18/h1-12H,13H2 |
| InChIKey | JHDLBTAZVRDOQA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 89.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|